C35H40N+ — CID 158405550
5-(1-deuteriocyclopentyl)-1,4-dimethyl-2-(2,5,5,6,6-pentamethylbenzo[a]anthracen-1-yl)pyridin-1-ium (PubChem CID 158405550) has the molecular formula C35H40N+ and a molecular weight of 475.72 g/mol. Its IUPAC name is 5-(1-deuteriocyclopentyl)-1,4-dimethyl-2-(2,5,5,6,6-pentamethylbenzo[a]anthracen-1-yl)pyridin-1-ium.
| Compound Name | 5-(1-deuteriocyclopentyl)-1,4-dimethyl-2-(2,5,5,6,6-pentamethylbenzo[a]anthracen-1-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 158405550 |
| Molecular Formula | C35H40N+ |
| Molecular Weight | 475.72 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | 5-(1-deuteriocyclopentyl)-1,4-dimethyl-2-(2,5,5,6,6-pentamethylbenzo[a]anthracen-1-yl)pyridin-1-ium |
| SMILES | [2H]C1(c2c[n+](C)c(-c3c(C)ccc4c3-c3cc5ccccc5cc3C(C)(C)C4(C)C)cc2C)CCCC1 |
| InChI | InChI=1S/C35H40N/c1-22-16-17-29-33(32(22)31-18-23(2)28(21-36(31)7)24-12-8-9-13-24)27-19-25-14-10-11-15-26(25)20-30(27)35(5,6)34(29,3)4/h10-11,14-21,24H,8-9,12-13H2,1-7H3/q+1/i24D |
| InChIKey | GDEZEBRPHJBBQB-CORJAIEOSA-N |
| XLogP | 8.84 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.72 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|