C37H38N+ — CID 161114875
1,4-dimethyl-2-(2,5,5,6,6-pentamethylbenzo[a]anthracen-3-yl)-5-[2-(trideuteriomethyl)phenyl]pyridin-1-ium (PubChem CID 161114875) has the molecular formula C37H38N+ and a molecular weight of 499.74 g/mol. Its IUPAC name is 1,4-dimethyl-2-(2,5,5,6,6-pentamethylbenzo[a]anthracen-3-yl)-5-[2-(trideuteriomethyl)phenyl]pyridin-1-ium.
| Compound Name | 1,4-dimethyl-2-(2,5,5,6,6-pentamethylbenzo[a]anthracen-3-yl)-5-[2-(trideuteriomethyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 161114875 |
| Molecular Formula | C37H38N+ |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | 1,4-dimethyl-2-(2,5,5,6,6-pentamethylbenzo[a]anthracen-3-yl)-5-[2-(trideuteriomethyl)phenyl]pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccccc1-c1c[n+](C)c(-c2cc3c(cc2C)-c2cc4ccccc4cc2C(C)(C)C3(C)C)cc1C |
| InChI | InChI=1S/C37H38N/c1-23-13-9-12-16-28(23)32-22-38(8)35(18-25(32)3)29-21-34-30(17-24(29)2)31-19-26-14-10-11-15-27(26)20-33(31)36(4,5)37(34,6)7/h9-22H,1-8H3/q+1/i1D3 |
| InChIKey | GUSVWSBRVXWOFA-FIBGUPNXSA-N |
| XLogP | 9.16 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|