C26H22F8N+ — CID 165383701
1-methyl-2-[2-methyl-5-(5,5,6,6,7,7,8,8-octafluoronaphthalen-1-yl)-4-(trideuteriomethyl)phenyl]-4,5-bis(trideuteriomethyl)pyridin-1-ium (PubChem CID 165383701) has the molecular formula C26H22F8N+ and a molecular weight of 509.51 g/mol. Its IUPAC name is 1-methyl-2-[2-methyl-5-(5,5,6,6,7,7,8,8-octafluoronaphthalen-1-yl)-4-(trideuteriomethyl)phenyl]-4,5-bis(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-[2-methyl-5-(5,5,6,6,7,7,8,8-octafluoronaphthalen-1-yl)-4-(trideuteriomethyl)phenyl]-4,5-bis(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 165383701 |
| Molecular Formula | C26H22F8N+ |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 1-methyl-2-[2-methyl-5-(5,5,6,6,7,7,8,8-octafluoronaphthalen-1-yl)-4-(trideuteriomethyl)phenyl]-4,5-bis(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2cc(C([2H])([2H])[2H])c(C([2H])([2H])[2H])c[n+]2C)cc1-c1cccc2c1C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C26H22F8N/c1-13-10-21(35(5)12-16(13)4)19-11-18(14(2)9-15(19)3)17-7-6-8-20-22(17)24(29,30)26(33,34)25(31,32)23(20,27)28/h6-12H,1-5H3/q+1/i1D3,2D3,4D3 |
| InChIKey | ZDWIZOVTVSRNIO-FZGWONOOSA-N |
| XLogP | 7.55 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|