C27H23N2+ — CID 165161149
4-methyl-5-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene (PubChem CID 165161149) has the molecular formula C27H23N2+ and a molecular weight of 381.53 g/mol. Its IUPAC name is 4-methyl-5-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene.
| Compound Name | 4-methyl-5-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
|---|---|
| PubChem CID | 165161149 |
| Molecular Formula | C27H23N2+ |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-methyl-5-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
| SMILES | [2H]C([2H])([2H])c1cc(-c2cc3c4cccc5c6ccccc6n(c3cc2C)c54)[n+](C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C27H23N2/c1-16-12-25(28(4)15-18(16)3)22-14-23-21-10-7-9-20-19-8-5-6-11-24(19)29(27(20)21)26(23)13-17(22)2/h5-15H,1-4H3/q+1/i1D3,3D3 |
| InChIKey | MFZCWKMNGQGOAX-WTJPRRJNSA-N |
| XLogP | 6.25 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|