C31H25N2+ — CID 165161283
6-methyl-7-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-12-azahexacyclo[10.10.1.02,11.04,9.013,18.019,23]tricosa-1(22),2(11),3,5,7,9,13,15,17,19(23),20-undecaene (PubChem CID 165161283) has the molecular formula C31H25N2+ and a molecular weight of 431.59 g/mol. Its IUPAC name is 6-methyl-7-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-12-azahexacyclo[10.10.1.02,11.04,9.013,18.019,23]tricosa-1(22),2(11),3,5,7,9,13,15,17,19(23),20-undecaene.
| Compound Name | 6-methyl-7-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-12-azahexacyclo[10.10.1.02,11.04,9.013,18.019,23]tricosa-1(22),2(11),3,5,7,9,13,15,17,19(23),20-undecaene |
|---|---|
| PubChem CID | 165161283 |
| Molecular Formula | C31H25N2+ |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 6-methyl-7-[1-methyl-4,5-bis(trideuteriomethyl)pyridin-1-ium-2-yl]-12-azahexacyclo[10.10.1.02,11.04,9.013,18.019,23]tricosa-1(22),2(11),3,5,7,9,13,15,17,19(23),20-undecaene |
| SMILES | [2H]C([2H])([2H])c1cc(-c2cc3cc4c(cc3cc2C)c2cccc3c5ccccc5n4c32)[n+](C)cc1C([2H])([2H])[2H] |
| InChI | InChI=1S/C31H25N2/c1-18-13-29(32(4)17-20(18)3)26-14-22-16-30-27(15-21(22)12-19(26)2)25-10-7-9-24-23-8-5-6-11-28(23)33(30)31(24)25/h5-17H,1-4H3/q+1/i1D3,3D3 |
| InChIKey | BLKXNOLZRVJPOQ-WTJPRRJNSA-N |
| XLogP | 7.41 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|