C16H20N+ — CID 164823768
1-methyl-2-(2-methylphenyl)-4-(1,1,2,2,2-pentadeuterioethyl)-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 164823768) has the molecular formula C16H20N+ and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-methyl-2-(2-methylphenyl)-4-(1,1,2,2,2-pentadeuterioethyl)-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(2-methylphenyl)-4-(1,1,2,2,2-pentadeuterioethyl)-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 164823768 |
| Molecular Formula | C16H20N+ |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-methyl-2-(2-methylphenyl)-4-(1,1,2,2,2-pentadeuterioethyl)-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2ccccc2C)cc1C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C16H20N/c1-5-14-10-16(17(4)11-13(14)3)15-9-7-6-8-12(15)2/h6-11H,5H2,1-4H3/q+1/i1D3,3D3,5D2 |
| InChIKey | XSRRLMNNYNVXPD-ZSQVNIDUSA-N |
| XLogP | 3.36 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|