C35H30N+ — CID 160610617
4-(1,8-dideuterio-5-methyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9,11,13,15,17,19-nonaenyl)-1-methyl-2-(2-methylphenyl)-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 160610617) has the molecular formula C35H30N+ and a molecular weight of 469.66 g/mol. Its IUPAC name is 4-(1,8-dideuterio-5-methyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9,11,13,15,17,19-nonaenyl)-1-methyl-2-(2-methylphenyl)-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 4-(1,8-dideuterio-5-methyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9,11,13,15,17,19-nonaenyl)-1-methyl-2-(2-methylphenyl)-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 160610617 |
| Molecular Formula | C35H30N+ |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 4-(1,8-dideuterio-5-methyl-4-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9,11,13,15,17,19-nonaenyl)-1-methyl-2-(2-methylphenyl)-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2ccccc2C)cc1-c1cc2c(cc1C)C1([2H])c3ccccc3C2([2H])c2ccccc21 |
| InChI | InChI=1S/C35H30N/c1-21-11-5-6-12-24(21)33-19-30(23(3)20-36(33)4)29-18-32-31(17-22(29)2)34-25-13-7-9-15-27(25)35(32)28-16-10-8-14-26(28)34/h5-20,34-35H,1-4H3/q+1/i3D3,34D,35D |
| InChIKey | YPFODCYVSMGVDO-SINIFURZSA-N |
| XLogP | 7.76 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|