C16H20N+ — CID 164823798
5-ethyl-1-methyl-2-(2-methylphenyl)-4-(trideuteriomethyl)pyridin-1-ium (PubChem CID 164823798) has the molecular formula C16H20N+ and a molecular weight of 229.36 g/mol. Its IUPAC name is 5-ethyl-1-methyl-2-(2-methylphenyl)-4-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 5-ethyl-1-methyl-2-(2-methylphenyl)-4-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 164823798 |
| Molecular Formula | C16H20N+ |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 5-ethyl-1-methyl-2-(2-methylphenyl)-4-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc(-c2ccccc2C)[n+](C)cc1CC |
| InChI | InChI=1S/C16H20N/c1-5-14-11-17(4)16(10-13(14)3)15-9-7-6-8-12(15)2/h6-11H,5H2,1-4H3/q+1/i3D3 |
| InChIKey | FRXWBJGYIJOPAF-HPRDVNIFSA-N |
| XLogP | 3.36 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|