C26H32N+ — CID 140920748
5-(2,2-dimethylpropyl)-1,4-dimethyl-2-[2-methyl-5-(2-methylphenyl)phenyl]pyridin-1-ium (PubChem CID 140920748) has the molecular formula C26H32N+ and a molecular weight of 358.55 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-1,4-dimethyl-2-[2-methyl-5-(2-methylphenyl)phenyl]pyridin-1-ium.
| Compound Name | 5-(2,2-dimethylpropyl)-1,4-dimethyl-2-[2-methyl-5-(2-methylphenyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 140920748 |
| Molecular Formula | C26H32N+ |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-1,4-dimethyl-2-[2-methyl-5-(2-methylphenyl)phenyl]pyridin-1-ium |
| SMILES | Cc1cc(-c2cc(-c3ccccc3C)ccc2C)[n+](C)cc1CC(C)(C)C |
| InChI | InChI=1S/C26H32N/c1-18-10-8-9-11-23(18)21-13-12-19(2)24(15-21)25-14-20(3)22(17-27(25)7)16-26(4,5)6/h8-15,17H,16H2,1-7H3/q+1 |
| InChIKey | RLCGAAVTSQJWKB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|