C34H39N2+ — CID 140830158
5-(1-deuteriocyclohexyl)-1-methyl-2-(2-methylphenyl)-4-(6-piperidin-1-ylnaphthalen-2-yl)pyridin-1-ium (PubChem CID 140830158) has the molecular formula C34H39N2+ and a molecular weight of 476.71 g/mol. Its IUPAC name is 5-(1-deuteriocyclohexyl)-1-methyl-2-(2-methylphenyl)-4-(6-piperidin-1-ylnaphthalen-2-yl)pyridin-1-ium.
| Compound Name | 5-(1-deuteriocyclohexyl)-1-methyl-2-(2-methylphenyl)-4-(6-piperidin-1-ylnaphthalen-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 140830158 |
| Molecular Formula | C34H39N2+ |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | 5-(1-deuteriocyclohexyl)-1-methyl-2-(2-methylphenyl)-4-(6-piperidin-1-ylnaphthalen-2-yl)pyridin-1-ium |
| SMILES | [2H]C1(c2c[n+](C)c(-c3ccccc3C)cc2-c2ccc3cc(N4CCCCC4)ccc3c2)CCCCC1 |
| InChI | InChI=1S/C34H39N2/c1-25-11-7-8-14-31(25)34-23-32(33(24-35(34)2)26-12-5-3-6-13-26)29-16-15-28-22-30(18-17-27(28)21-29)36-19-9-4-10-20-36/h7-8,11,14-18,21-24,26H,3-6,9-10,12-13,19-20H2,1-2H3/q+1/i26D |
| InChIKey | OSJTUNLGQWWPPK-HKAOEGRMSA-N |
| XLogP | 8.34 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|