C26H25FN+ — CID 140830033
5-(2-deuteriopropan-2-yl)-4-(6-fluoronaphthalen-2-yl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 140830033) has the molecular formula C26H25FN+ and a molecular weight of 371.50 g/mol. Its IUPAC name is 5-(2-deuteriopropan-2-yl)-4-(6-fluoronaphthalen-2-yl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 5-(2-deuteriopropan-2-yl)-4-(6-fluoronaphthalen-2-yl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140830033 |
| Molecular Formula | C26H25FN+ |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 5-(2-deuteriopropan-2-yl)-4-(6-fluoronaphthalen-2-yl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | [2H]C(C)(C)c1c[n+](C)c(-c2ccccc2C)cc1-c1ccc2cc(F)ccc2c1 |
| InChI | InChI=1S/C26H25FN/c1-17(2)25-16-28(4)26(23-8-6-5-7-18(23)3)15-24(25)21-10-9-20-14-22(27)12-11-19(20)13-21/h5-17H,1-4H3/q+1/i17D |
| InChIKey | IEEFYUUFBAYHQG-OKWSDYJOSA-N |
| XLogP | 6.57 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|