C28H32N+ — CID 158316417
5-cyclohexyl-2-(2,4-dimethyl-9H-fluoren-1-yl)-1,4-dimethylpyridin-1-ium (PubChem CID 158316417) has the molecular formula C28H32N+ and a molecular weight of 382.57 g/mol. Its IUPAC name is 5-cyclohexyl-2-(2,4-dimethyl-9H-fluoren-1-yl)-1,4-dimethylpyridin-1-ium.
| Compound Name | 5-cyclohexyl-2-(2,4-dimethyl-9H-fluoren-1-yl)-1,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 158316417 |
| Molecular Formula | C28H32N+ |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 5-cyclohexyl-2-(2,4-dimethyl-9H-fluoren-1-yl)-1,4-dimethylpyridin-1-ium |
| SMILES | Cc1cc(-c2c(C)cc(C)c3c2Cc2ccccc2-3)[n+](C)cc1C1CCCCC1 |
| InChI | InChI=1S/C28H32N/c1-18-15-26(29(4)17-25(18)21-10-6-5-7-11-21)28-20(3)14-19(2)27-23-13-9-8-12-22(23)16-24(27)28/h8-9,12-15,17,21H,5-7,10-11,16H2,1-4H3/q+1 |
| InChIKey | HYTOVAQIGBPZIO-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|