C30H34N+ — CID 158825496
1,4,11,11-tetramethyl-5-(2,4,8-trimethyl-9H-fluoren-1-yl)-4-azoniatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 158825496) has the molecular formula C30H34N+ and a molecular weight of 408.61 g/mol. Its IUPAC name is 1,4,11,11-tetramethyl-5-(2,4,8-trimethyl-9H-fluoren-1-yl)-4-azoniatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | 1,4,11,11-tetramethyl-5-(2,4,8-trimethyl-9H-fluoren-1-yl)-4-azoniatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 158825496 |
| Molecular Formula | C30H34N+ |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 1,4,11,11-tetramethyl-5-(2,4,8-trimethyl-9H-fluoren-1-yl)-4-azoniatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | Cc1cccc2c1Cc1c-2c(C)cc(C)c1-c1cc2c(c[n+]1C)C1(C)CCC2C1(C)C |
| InChI | InChI=1S/C30H34N/c1-17-9-8-10-20-21(17)14-23-27(20)18(2)13-19(3)28(23)26-15-22-24-11-12-30(6,29(24,4)5)25(22)16-31(26)7/h8-10,13,15-16,24H,11-12,14H2,1-7H3/q+1 |
| InChIKey | INMLDNJHBHMBNO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|