C29H34N+ — CID 160606641
4-(4,4-dimethylcyclohexyl)-1,5-dimethyl-2-(2-methyl-9H-fluoren-1-yl)pyridin-1-ium (PubChem CID 160606641) has the molecular formula C29H34N+ and a molecular weight of 396.60 g/mol. Its IUPAC name is 4-(4,4-dimethylcyclohexyl)-1,5-dimethyl-2-(2-methyl-9H-fluoren-1-yl)pyridin-1-ium.
| Compound Name | 4-(4,4-dimethylcyclohexyl)-1,5-dimethyl-2-(2-methyl-9H-fluoren-1-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 160606641 |
| Molecular Formula | C29H34N+ |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | 4-(4,4-dimethylcyclohexyl)-1,5-dimethyl-2-(2-methyl-9H-fluoren-1-yl)pyridin-1-ium |
| SMILES | Cc1c[n+](C)c(-c2c(C)ccc3c2Cc2ccccc2-3)cc1C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C29H34N/c1-19-10-11-24-23-9-7-6-8-22(23)16-26(24)28(19)27-17-25(20(2)18-30(27)5)21-12-14-29(3,4)15-13-21/h6-11,17-18,21H,12-16H2,1-5H3/q+1 |
| InChIKey | UBBCQMIYBDWZOK-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|