C30H36N+ — CID 159298690
5-(4,4-dimethylcyclohexyl)-2-(2,6-dimethyl-9H-fluoren-1-yl)-1,4-dimethylpyridin-1-ium (PubChem CID 159298690) has the molecular formula C30H36N+ and a molecular weight of 410.63 g/mol. Its IUPAC name is 5-(4,4-dimethylcyclohexyl)-2-(2,6-dimethyl-9H-fluoren-1-yl)-1,4-dimethylpyridin-1-ium.
| Compound Name | 5-(4,4-dimethylcyclohexyl)-2-(2,6-dimethyl-9H-fluoren-1-yl)-1,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 159298690 |
| Molecular Formula | C30H36N+ |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 5-(4,4-dimethylcyclohexyl)-2-(2,6-dimethyl-9H-fluoren-1-yl)-1,4-dimethylpyridin-1-ium |
| SMILES | Cc1ccc2c(c1)-c1ccc(C)c(-c3cc(C)c(C4CCC(C)(C)CC4)c[n+]3C)c1C2 |
| InChI | InChI=1S/C30H36N/c1-19-7-9-23-17-26-24(25(23)15-19)10-8-20(2)29(26)28-16-21(3)27(18-31(28)6)22-11-13-30(4,5)14-12-22/h7-10,15-16,18,22H,11-14,17H2,1-6H3/q+1 |
| InChIKey | KCLTVPJZQIBTPC-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|