C23H21N2+ — CID 163861621
8-[1,6-dimethyl-4-(trideuteriomethyl)pyridin-1-ium-2-yl]-7-methyl-9H-fluorene-3-carbonitrile (PubChem CID 163861621) has the molecular formula C23H21N2+ and a molecular weight of 328.45 g/mol. Its IUPAC name is 8-[1,6-dimethyl-4-(trideuteriomethyl)pyridin-1-ium-2-yl]-7-methyl-9H-fluorene-3-carbonitrile.
| Compound Name | 8-[1,6-dimethyl-4-(trideuteriomethyl)pyridin-1-ium-2-yl]-7-methyl-9H-fluorene-3-carbonitrile |
|---|---|
| PubChem CID | 163861621 |
| Molecular Formula | C23H21N2+ |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 8-[1,6-dimethyl-4-(trideuteriomethyl)pyridin-1-ium-2-yl]-7-methyl-9H-fluorene-3-carbonitrile |
| SMILES | [2H]C([2H])([2H])c1cc(C)[n+](C)c(-c2c(C)ccc3c2Cc2ccc(C#N)cc2-3)c1 |
| InChI | InChI=1S/C23H21N2/c1-14-9-16(3)25(4)22(10-14)23-15(2)5-8-19-20-11-17(13-24)6-7-18(20)12-21(19)23/h5-11H,12H2,1-4H3/q+1/i1D3 |
| InChIKey | WOTZDFALKXQFJC-FIBGUPNXSA-N |
| XLogP | 4.55 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|