C27H21N2+ — CID 159136573
7-methyl-8-(1-methyl-4-phenylpyridin-1-ium-2-yl)-9H-fluorene-4-carbonitrile (PubChem CID 159136573) has the molecular formula C27H21N2+ and a molecular weight of 373.48 g/mol. Its IUPAC name is 7-methyl-8-(1-methyl-4-phenylpyridin-1-ium-2-yl)-9H-fluorene-4-carbonitrile.
| Compound Name | 7-methyl-8-(1-methyl-4-phenylpyridin-1-ium-2-yl)-9H-fluorene-4-carbonitrile |
|---|---|
| PubChem CID | 159136573 |
| Molecular Formula | C27H21N2+ |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 7-methyl-8-(1-methyl-4-phenylpyridin-1-ium-2-yl)-9H-fluorene-4-carbonitrile |
| SMILES | Cc1ccc2c(c1-c1cc(-c3ccccc3)cc[n+]1C)Cc1cccc(C#N)c1-2 |
| InChI | InChI=1S/C27H21N2/c1-18-11-12-23-24(15-21-9-6-10-22(17-28)27(21)23)26(18)25-16-20(13-14-29(25)2)19-7-4-3-5-8-19/h3-14,16H,15H2,1-2H3/q+1 |
| InChIKey | LDSJOCHSFQCXIT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|