C26H30N+ — CID 158886886
2-(2,6-dimethyl-9H-fluoren-1-yl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium (PubChem CID 158886886) has the molecular formula C26H30N+ and a molecular weight of 356.53 g/mol. Its IUPAC name is 2-(2,6-dimethyl-9H-fluoren-1-yl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium.
| Compound Name | 2-(2,6-dimethyl-9H-fluoren-1-yl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium |
|---|---|
| PubChem CID | 158886886 |
| Molecular Formula | C26H30N+ |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-(2,6-dimethyl-9H-fluoren-1-yl)-1,4-dimethyl-5-(2-methylpropyl)pyridin-1-ium |
| SMILES | Cc1ccc2c(c1)-c1ccc(C)c(-c3cc(C)c(CC(C)C)c[n+]3C)c1C2 |
| InChI | InChI=1S/C26H30N/c1-16(2)11-21-15-27(6)25(13-19(21)5)26-18(4)8-10-22-23-12-17(3)7-9-20(23)14-24(22)26/h7-10,12-13,15-16H,11,14H2,1-6H3/q+1 |
| InChIKey | WIDSWQJUUWNESB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|