C34H42N+ — CID 158870300
4-(3,3-dimethylspiro[5.5]undecan-9-yl)-1,5-dimethyl-2-(2-methyl-9H-fluoren-1-yl)pyridin-1-ium (PubChem CID 158870300) has the molecular formula C34H42N+ and a molecular weight of 464.72 g/mol. Its IUPAC name is 4-(3,3-dimethylspiro[5.5]undecan-9-yl)-1,5-dimethyl-2-(2-methyl-9H-fluoren-1-yl)pyridin-1-ium.
| Compound Name | 4-(3,3-dimethylspiro[5.5]undecan-9-yl)-1,5-dimethyl-2-(2-methyl-9H-fluoren-1-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 158870300 |
| Molecular Formula | C34H42N+ |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | 4-(3,3-dimethylspiro[5.5]undecan-9-yl)-1,5-dimethyl-2-(2-methyl-9H-fluoren-1-yl)pyridin-1-ium |
| SMILES | Cc1c[n+](C)c(-c2c(C)ccc3c2Cc2ccccc2-3)cc1C1CCC2(CC1)CCC(C)(C)CC2 |
| InChI | InChI=1S/C34H42N/c1-23-10-11-28-27-9-7-6-8-26(27)20-30(28)32(23)31-21-29(24(2)22-35(31)5)25-12-14-34(15-13-25)18-16-33(3,4)17-19-34/h6-11,21-22,25H,12-20H2,1-5H3/q+1 |
| InChIKey | QIVSJEMARGMFHC-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|