C19H24N+ — CID 140881400
2-[2-(1-deuteriocyclopentyl)-6-methylphenyl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 140881400) has the molecular formula C19H24N+ and a molecular weight of 270.43 g/mol. Its IUPAC name is 2-[2-(1-deuteriocyclopentyl)-6-methylphenyl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 2-[2-(1-deuteriocyclopentyl)-6-methylphenyl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140881400 |
| Molecular Formula | C19H24N+ |
| Molecular Weight | 270.43 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 2-[2-(1-deuteriocyclopentyl)-6-methylphenyl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2c(C)cccc2C2([2H])CCCC2)[n+](C)c1 |
| InChI | InChI=1S/C19H24N/c1-14-11-12-18(20(3)13-14)19-15(2)7-6-10-17(19)16-8-4-5-9-16/h6-7,10-13,16H,4-5,8-9H2,1-3H3/q+1/i1D3,16D |
| InChIKey | LLTSTPRHCDHTOC-KFHHUZHISA-N |
| XLogP | 4.45 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|