C26H30NO+ — CID 158045021
1-methyl-4-(4-methylphenyl)-2-(2,2,3,3,6-pentamethyl-1-benzofuran-7-yl)pyridin-1-ium (PubChem CID 158045021) has the molecular formula C26H30NO+ and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-methyl-4-(4-methylphenyl)-2-(2,2,3,3,6-pentamethyl-1-benzofuran-7-yl)pyridin-1-ium.
| Compound Name | 1-methyl-4-(4-methylphenyl)-2-(2,2,3,3,6-pentamethyl-1-benzofuran-7-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 158045021 |
| Molecular Formula | C26H30NO+ |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-methyl-4-(4-methylphenyl)-2-(2,2,3,3,6-pentamethyl-1-benzofuran-7-yl)pyridin-1-ium |
| SMILES | Cc1ccc(-c2cc[n+](C)c(-c3c(C)ccc4c3OC(C)(C)C4(C)C)c2)cc1 |
| InChI | InChI=1S/C26H30NO/c1-17-8-11-19(12-9-17)20-14-15-27(7)22(16-20)23-18(2)10-13-21-24(23)28-26(5,6)25(21,3)4/h8-16H,1-7H3/q+1 |
| InChIKey | NOVMPKIZYLJDKO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|