C38H38N+ — CID 140869290
1,4-dimethyl-2-(2-methyl-4-phenylphenyl)-5-(9,9,10,10-tetramethylanthracen-2-yl)pyridin-1-ium (PubChem CID 140869290) has the molecular formula C38H38N+ and a molecular weight of 508.73 g/mol. Its IUPAC name is 1,4-dimethyl-2-(2-methyl-4-phenylphenyl)-5-(9,9,10,10-tetramethylanthracen-2-yl)pyridin-1-ium.
| Compound Name | 1,4-dimethyl-2-(2-methyl-4-phenylphenyl)-5-(9,9,10,10-tetramethylanthracen-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 140869290 |
| Molecular Formula | C38H38N+ |
| Molecular Weight | 508.73 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 1,4-dimethyl-2-(2-methyl-4-phenylphenyl)-5-(9,9,10,10-tetramethylanthracen-2-yl)pyridin-1-ium |
| SMILES | Cc1cc(-c2ccc(-c3ccccc3)cc2C)[n+](C)cc1-c1ccc2c(c1)C(C)(C)c1ccccc1C2(C)C |
| InChI | InChI=1S/C38H38N/c1-25-21-28(27-13-9-8-10-14-27)17-19-30(25)36-22-26(2)31(24-39(36)7)29-18-20-34-35(23-29)38(5,6)33-16-12-11-15-32(33)37(34,3)4/h8-24H,1-7H3/q+1 |
| InChIKey | RNSIQBKNUMMRIJ-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.73 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|