C39H36FN2+ — CID 169283100
8-(5-tert-butyl-4-fluoro-1-methylpyridin-1-ium-2-yl)-7,9,9-trimethyl-1-(4-phenylphenyl)fluorene-2-carbonitrile (PubChem CID 169283100) has the molecular formula C39H36FN2+ and a molecular weight of 551.73 g/mol. Its IUPAC name is 8-(5-tert-butyl-4-fluoro-1-methylpyridin-1-ium-2-yl)-7,9,9-trimethyl-1-(4-phenylphenyl)fluorene-2-carbonitrile.
| Compound Name | 8-(5-tert-butyl-4-fluoro-1-methylpyridin-1-ium-2-yl)-7,9,9-trimethyl-1-(4-phenylphenyl)fluorene-2-carbonitrile |
|---|---|
| PubChem CID | 169283100 |
| Molecular Formula | C39H36FN2+ |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | 8-(5-tert-butyl-4-fluoro-1-methylpyridin-1-ium-2-yl)-7,9,9-trimethyl-1-(4-phenylphenyl)fluorene-2-carbonitrile |
| SMILES | Cc1ccc2c(c1-c1cc(F)c(C(C)(C)C)c[n+]1C)C(C)(C)c1c-2ccc(C#N)c1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C39H36FN2/c1-24-13-19-29-30-20-18-28(22-41)35(27-16-14-26(15-17-27)25-11-9-8-10-12-25)37(30)39(5,6)36(29)34(24)33-21-32(40)31(23-42(33)7)38(2,3)4/h8-21,23H,1-7H3/q+1 |
| InChIKey | WIKKXOIJXBIACV-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|