C36H30FN2S+ — CID 169283058
6-(4-tert-butyl-5-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyl-4-(4-phenylphenyl)dibenzothiophene-3-carbonitrile (PubChem CID 169283058) has the molecular formula C36H30FN2S+ and a molecular weight of 541.72 g/mol. Its IUPAC name is 6-(4-tert-butyl-5-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyl-4-(4-phenylphenyl)dibenzothiophene-3-carbonitrile.
| Compound Name | 6-(4-tert-butyl-5-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyl-4-(4-phenylphenyl)dibenzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 169283058 |
| Molecular Formula | C36H30FN2S+ |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 6-(4-tert-butyl-5-fluoro-1-methylpyridin-1-ium-2-yl)-7-methyl-4-(4-phenylphenyl)dibenzothiophene-3-carbonitrile |
| SMILES | Cc1ccc2c(sc3c(-c4ccc(-c5ccccc5)cc4)c(C#N)ccc32)c1-c1cc(C(C)(C)C)c(F)c[n+]1C |
| InChI | InChI=1S/C36H30FN2S/c1-22-11-17-27-28-18-16-26(20-38)33(25-14-12-24(13-15-25)23-9-7-6-8-10-23)35(28)40-34(27)32(22)31-19-29(36(2,3)4)30(37)21-39(31)5/h6-19,21H,1-5H3/q+1 |
| InChIKey | XGQIDPOKCVNSHB-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|