C33H22N3S+ — CID 166043397
4-[3-(4-cyanophenyl)phenyl]-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzothiophene-3-carbonitrile (PubChem CID 166043397) has the molecular formula C33H22N3S+ and a molecular weight of 492.63 g/mol. Its IUPAC name is 4-[3-(4-cyanophenyl)phenyl]-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzothiophene-3-carbonitrile.
| Compound Name | 4-[3-(4-cyanophenyl)phenyl]-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 166043397 |
| Molecular Formula | C33H22N3S+ |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 4-[3-(4-cyanophenyl)phenyl]-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzothiophene-3-carbonitrile |
| SMILES | Cc1ccc2c(sc3c(-c4cccc(-c5ccc(C#N)cc5)c4)c(C#N)ccc32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C33H22N3S/c1-21-9-15-27-28-16-14-26(20-35)31(33(28)37-32(27)30(21)29-8-3-4-17-36(29)2)25-7-5-6-24(18-25)23-12-10-22(19-34)11-13-23/h3-18H,1-2H3/q+1 |
| InChIKey | WXANGHWVUOORBN-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 51.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|