C21H17N2S+ — CID 170252001
2,7-dimethyl-6-(1-methylpyridin-1-ium-2-yl)dibenzothiophene-3-carbonitrile (PubChem CID 170252001) has the molecular formula C21H17N2S+ and a molecular weight of 329.45 g/mol. Its IUPAC name is 2,7-dimethyl-6-(1-methylpyridin-1-ium-2-yl)dibenzothiophene-3-carbonitrile.
| Compound Name | 2,7-dimethyl-6-(1-methylpyridin-1-ium-2-yl)dibenzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 170252001 |
| Molecular Formula | C21H17N2S+ |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2,7-dimethyl-6-(1-methylpyridin-1-ium-2-yl)dibenzothiophene-3-carbonitrile |
| SMILES | Cc1cc2c(cc1C#N)sc1c(-c3cccc[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C21H17N2S/c1-13-7-8-16-17-10-14(2)15(12-22)11-19(17)24-21(16)20(13)18-6-4-5-9-23(18)3/h4-11H,1-3H3/q+1 |
| InChIKey | BONZFDXXCZEGKL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|