C43H48N2+2 — CID 123822316
3'-butyl-10,11',11'-triethyl-20',20'-dimethylspiro[7H-benzo[a]quinolizin-5-ium-6,10'-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12,14,16-octaene] (PubChem CID 123822316) has the molecular formula C43H48N2+2 and a molecular weight of 592.87 g/mol. Its IUPAC name is 3'-butyl-10,11',11'-triethyl-20',20'-dimethylspiro[7H-benzo[a]quinolizin-5-ium-6,10'-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12,14,16-octaene].
| Compound Name | 3'-butyl-10,11',11'-triethyl-20',20'-dimethylspiro[7H-benzo[a]quinolizin-5-ium-6,10'-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12,14,16-octaene] |
|---|---|
| PubChem CID | 123822316 |
| Molecular Formula | C43H48N2+2 |
| Molecular Weight | 592.87 g/mol |
| Exact Mass | 592.38 |
| IUPAC Name | 3'-butyl-10,11',11'-triethyl-20',20'-dimethylspiro[7H-benzo[a]quinolizin-5-ium-6,10'-8-azoniapentacyclo[14.3.1.05,19.08,18.012,17]icosa-1(19),2,4,6,8(18),12,14,16-octaene] |
| SMILES | CCCCc1cc2c3c4[n+](ccc3c1)CC1(Cc3ccc(CC)cc3-c3cccc[n+]31)C(CC)(CC)c1cccc(c1-4)C2(C)C |
| InChI | InChI=1S/C43H48N2/c1-7-11-15-30-24-31-21-23-44-28-43(27-32-20-19-29(8-2)25-33(32)37-18-12-13-22-45(37)43)42(9-3,10-4)35-17-14-16-34-39(35)40(44)38(31)36(26-30)41(34,5)6/h12-14,16-26H,7-11,15,27-28H2,1-6H3/q+2 |
| InChIKey | LUMPDEDCYWCDLW-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.87 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|