C26H32N+ — CID 123304837
2-ethyl-5-methyl-14-[(1-methylcyclohexyl)methyl]-1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(12),3,6,8,10,13,15-heptaene (PubChem CID 123304837) has the molecular formula C26H32N+ and a molecular weight of 358.55 g/mol. Its IUPAC name is 2-ethyl-5-methyl-14-[(1-methylcyclohexyl)methyl]-1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(12),3,6,8,10,13,15-heptaene.
| Compound Name | 2-ethyl-5-methyl-14-[(1-methylcyclohexyl)methyl]-1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(12),3,6,8,10,13,15-heptaene |
|---|---|
| PubChem CID | 123304837 |
| Molecular Formula | C26H32N+ |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-ethyl-5-methyl-14-[(1-methylcyclohexyl)methyl]-1-azoniatetracyclo[10.4.0.02,5.06,11]hexadeca-1(12),3,6,8,10,13,15-heptaene |
| SMILES | CCC12C=CC1(C)c1ccccc1-c1cc(CC3(C)CCCCC3)cc[n+]12 |
| InChI | InChI=1S/C26H32N/c1-4-26-16-15-25(26,3)22-11-7-6-10-21(22)23-18-20(12-17-27(23)26)19-24(2)13-8-5-9-14-24/h6-7,10-12,15-18H,4-5,8-9,13-14,19H2,1-3H3/q+1 |
| InChIKey | PUHVTIZFLIZHAT-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|