C37H34N2+2 — CID 170052308
1,17,26-trimethyl-2-methylidene-27-phenyl-3,29-diazoniahexacyclo[15.12.0.03,8.09,14.018,23.024,29]nonacosa-3,5,7,9,11,13,18,20,22,24(29),25,27-dodecaene (PubChem CID 170052308) has the molecular formula C37H34N2+2 and a molecular weight of 506.69 g/mol. Its IUPAC name is 1,17,26-trimethyl-2-methylidene-27-phenyl-3,29-diazoniahexacyclo[15.12.0.03,8.09,14.018,23.024,29]nonacosa-3,5,7,9,11,13,18,20,22,24(29),25,27-dodecaene.
| Compound Name | 1,17,26-trimethyl-2-methylidene-27-phenyl-3,29-diazoniahexacyclo[15.12.0.03,8.09,14.018,23.024,29]nonacosa-3,5,7,9,11,13,18,20,22,24(29),25,27-dodecaene |
|---|---|
| PubChem CID | 170052308 |
| Molecular Formula | C37H34N2+2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 1,17,26-trimethyl-2-methylidene-27-phenyl-3,29-diazoniahexacyclo[15.12.0.03,8.09,14.018,23.024,29]nonacosa-3,5,7,9,11,13,18,20,22,24(29),25,27-dodecaene |
| SMILES | C=C1[n+]2ccccc2-c2ccccc2CCC2(C)c3ccccc3-c3cc(C)c(-c4ccccc4)c[n+]3C12C |
| InChI | InChI=1S/C37H34N2/c1-26-24-35-31-18-10-11-19-33(31)36(3)22-21-29-16-8-9-17-30(29)34-20-12-13-23-38(34)27(2)37(36,4)39(35)25-32(26)28-14-6-5-7-15-28/h5-20,23-25H,2,21-22H2,1,3-4H3/q+2 |
| InChIKey | VZCHQIBQSQOACI-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|