C36H27N3+2 — CID 170010292
2-methylidene-6-phenyl-3,30-diazoniaheptacyclo[22.5.1.01,17.03,8.09,14.018,23.028,30]triaconta-3(8),4,6,9,11,13,18(23),19,21,24,26,28(30)-dodecaene-20-carbonitrile (PubChem CID 170010292) has the molecular formula C36H27N3+2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2-methylidene-6-phenyl-3,30-diazoniaheptacyclo[22.5.1.01,17.03,8.09,14.018,23.028,30]triaconta-3(8),4,6,9,11,13,18(23),19,21,24,26,28(30)-dodecaene-20-carbonitrile.
| Compound Name | 2-methylidene-6-phenyl-3,30-diazoniaheptacyclo[22.5.1.01,17.03,8.09,14.018,23.028,30]triaconta-3(8),4,6,9,11,13,18(23),19,21,24,26,28(30)-dodecaene-20-carbonitrile |
|---|---|
| PubChem CID | 170010292 |
| Molecular Formula | C36H27N3+2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 2-methylidene-6-phenyl-3,30-diazoniaheptacyclo[22.5.1.01,17.03,8.09,14.018,23.028,30]triaconta-3(8),4,6,9,11,13,18(23),19,21,24,26,28(30)-dodecaene-20-carbonitrile |
| SMILES | C=C1[n+]2ccc(-c3ccccc3)cc2-c2ccccc2CCC2c3cc(C#N)ccc3-c3cccc4[n+]3C12C4 |
| InChI | InChI=1S/C36H27N3/c1-24-36-22-29-11-7-13-34(39(29)36)31-16-14-25(23-37)20-32(31)33(36)17-15-27-10-5-6-12-30(27)35-21-28(18-19-38(24)35)26-8-3-2-4-9-26/h2-14,16,18-21,33H,1,15,17,22H2/q+2 |
| InChIKey | JHUQPRNAGKWZIP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 31.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|