C60H48N4 — CID 155475628
7-[5'-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,10,10-trimethylspiro[1,2,3,4-tetrahydroanthracene-9,9'-fluorene]-3'-yl]-9,9-dimethylfluorene-2-carbonitrile (PubChem CID 155475628) has the molecular formula C60H48N4 and a molecular weight of 825.07 g/mol. Its IUPAC name is 7-[5'-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,10,10-trimethylspiro[1,2,3,4-tetrahydroanthracene-9,9'-fluorene]-3'-yl]-9,9-dimethylfluorene-2-carbonitrile.
| Compound Name | 7-[5'-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,10,10-trimethylspiro[1,2,3,4-tetrahydroanthracene-9,9'-fluorene]-3'-yl]-9,9-dimethylfluorene-2-carbonitrile |
|---|---|
| PubChem CID | 155475628 |
| Molecular Formula | C60H48N4 |
| Molecular Weight | 825.07 g/mol |
| Exact Mass | 824.39 |
| IUPAC Name | 7-[5'-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,10,10-trimethylspiro[1,2,3,4-tetrahydroanthracene-9,9'-fluorene]-3'-yl]-9,9-dimethylfluorene-2-carbonitrile |
| SMILES | CC1CCC2=C(C1)C1(c3ccc(-c4ccc5c(c4)C(C)(C)c4cc(C#N)ccc4-5)cc3-c3c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cccc31)c1ccccc1C2(C)C |
| InChI | InChI=1S/C60H48N4/c1-36-23-29-48-53(31-36)60(49-21-13-12-20-47(49)58(48,2)3)46-30-26-40(41-25-28-43-42-27-24-37(35-61)32-51(42)59(4,5)52(43)34-41)33-45(46)54-44(19-14-22-50(54)60)57-63-55(38-15-8-6-9-16-38)62-56(64-57)39-17-10-7-11-18-39/h6-22,24-28,30,32-34,36H,23,29,31H2,1-5H3 |
| InChIKey | ICCKTVWBEOFOSX-UHFFFAOYSA-N |
| XLogP | 14.44 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.07 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|