C64H44N6 — CID 153293179
2-[9,9-dimethyl-6'-[4-phenyl-6-(2-phenylphenyl)-1,3,5-triazin-2-yl]spiro[anthracene-10,9'-fluorene]-4'-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 153293179) has the molecular formula C64H44N6 and a molecular weight of 897.10 g/mol. Its IUPAC name is 2-[9,9-dimethyl-6'-[4-phenyl-6-(2-phenylphenyl)-1,3,5-triazin-2-yl]spiro[anthracene-10,9'-fluorene]-4'-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[9,9-dimethyl-6'-[4-phenyl-6-(2-phenylphenyl)-1,3,5-triazin-2-yl]spiro[anthracene-10,9'-fluorene]-4'-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 153293179 |
| Molecular Formula | C64H44N6 |
| Molecular Weight | 897.10 g/mol |
| Exact Mass | 896.36 |
| IUPAC Name | 2-[9,9-dimethyl-6'-[4-phenyl-6-(2-phenylphenyl)-1,3,5-triazin-2-yl]spiro[anthracene-10,9'-fluorene]-4'-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2C2(c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5-c5ccccc5)n4)cc3-c3c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cccc32)c2ccccc21 |
| InChI | InChI=1S/C64H44N6/c1-63(2)51-33-17-19-35-53(51)64(54-36-20-18-34-52(54)63)50-39-38-45(60-66-59(44-28-13-6-14-29-44)67-61(70-60)47-31-16-15-30-46(47)41-22-7-3-8-23-41)40-49(50)56-48(32-21-37-55(56)64)62-68-57(42-24-9-4-10-25-42)65-58(69-62)43-26-11-5-12-27-43/h3-40H,1-2H3 |
| InChIKey | FRMVEFVZXRAMHL-UHFFFAOYSA-N |
| XLogP | 14.73 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.10 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |