C59H42N4 — CID 152784845
7-[5'-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylspiro[anthracene-10,9'-fluorene]-3'-yl]-9,9-dimethylfluorene-2-carbonitrile (PubChem CID 152784845) has the molecular formula C59H42N4 and a molecular weight of 807.01 g/mol. Its IUPAC name is 7-[5'-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylspiro[anthracene-10,9'-fluorene]-3'-yl]-9,9-dimethylfluorene-2-carbonitrile.
| Compound Name | 7-[5'-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylspiro[anthracene-10,9'-fluorene]-3'-yl]-9,9-dimethylfluorene-2-carbonitrile |
|---|---|
| PubChem CID | 152784845 |
| Molecular Formula | C59H42N4 |
| Molecular Weight | 807.01 g/mol |
| Exact Mass | 806.34 |
| IUPAC Name | 7-[5'-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylspiro[anthracene-10,9'-fluorene]-3'-yl]-9,9-dimethylfluorene-2-carbonitrile |
| SMILES | CC1(C)c2cc(C#N)ccc2-c2ccc(-c3ccc4c(c3)-c3c(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cccc3C43c4ccccc4C(C)(C)c4ccccc43)cc21 |
| InChI | InChI=1S/C59H42N4/c1-57(2)46-21-11-13-23-48(46)59(49-24-14-12-22-47(49)57)45-31-28-39(40-27-30-42-41-29-26-36(35-60)32-51(41)58(3,4)52(42)34-40)33-44(45)53-43(20-15-25-50(53)59)56-62-54(37-16-7-5-8-17-37)61-55(63-56)38-18-9-6-10-19-38/h5-34H,1-4H3 |
| InChIKey | RUPWSLOVKKBZQG-UHFFFAOYSA-N |
| XLogP | 13.72 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.01 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |