C38H27N5+2 — CID 170018691
27-methyl-2-methylidene-6-phenyl-3,29-diazoniahexacyclo[15.12.0.03,8.09,14.018,23.024,29]nonacosa-3(8),4,6,9,11,13,18(23),19,21,24(29),25,27-dodecaene-19,20,21-tricarbonitrile (PubChem CID 170018691) has the molecular formula C38H27N5+2 and a molecular weight of 553.67 g/mol. Its IUPAC name is 27-methyl-2-methylidene-6-phenyl-3,29-diazoniahexacyclo[15.12.0.03,8.09,14.018,23.024,29]nonacosa-3(8),4,6,9,11,13,18(23),19,21,24(29),25,27-dodecaene-19,20,21-tricarbonitrile.
| Compound Name | 27-methyl-2-methylidene-6-phenyl-3,29-diazoniahexacyclo[15.12.0.03,8.09,14.018,23.024,29]nonacosa-3(8),4,6,9,11,13,18(23),19,21,24(29),25,27-dodecaene-19,20,21-tricarbonitrile |
|---|---|
| PubChem CID | 170018691 |
| Molecular Formula | C38H27N5+2 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 27-methyl-2-methylidene-6-phenyl-3,29-diazoniahexacyclo[15.12.0.03,8.09,14.018,23.024,29]nonacosa-3(8),4,6,9,11,13,18(23),19,21,24(29),25,27-dodecaene-19,20,21-tricarbonitrile |
| SMILES | C=C1C2C(CCc3ccccc3-c3cc(-c4ccccc4)cc[n+]31)c1c(cc(C#N)c(C#N)c1C#N)-c1ccc(C)c[n+]12 |
| InChI | InChI=1S/C38H27N5/c1-24-12-15-35-32-18-29(20-39)33(21-40)34(22-41)37(32)31-14-13-27-10-6-7-11-30(27)36-19-28(26-8-4-3-5-9-26)16-17-42(36)25(2)38(31)43(35)23-24/h3-12,15-19,23,31,38H,2,13-14H2,1H3/q+2 |
| InChIKey | AQBPSJZZYOOQKU-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|