C42H44N2+2 — CID 170126479
5,27-ditert-butyl-2-methylidene-11-phenyl-3,29-diazoniahexacyclo[15.12.0.03,8.09,14.018,23.024,29]nonacosa-3(8),4,6,9(14),10,12,18,20,22,24(29),25,27-dodecaene (PubChem CID 170126479) has the molecular formula C42H44N2+2 and a molecular weight of 576.83 g/mol. Its IUPAC name is 5,27-ditert-butyl-2-methylidene-11-phenyl-3,29-diazoniahexacyclo[15.12.0.03,8.09,14.018,23.024,29]nonacosa-3(8),4,6,9(14),10,12,18,20,22,24(29),25,27-dodecaene.
| Compound Name | 5,27-ditert-butyl-2-methylidene-11-phenyl-3,29-diazoniahexacyclo[15.12.0.03,8.09,14.018,23.024,29]nonacosa-3(8),4,6,9(14),10,12,18,20,22,24(29),25,27-dodecaene |
|---|---|
| PubChem CID | 170126479 |
| Molecular Formula | C42H44N2+2 |
| Molecular Weight | 576.83 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | 5,27-ditert-butyl-2-methylidene-11-phenyl-3,29-diazoniahexacyclo[15.12.0.03,8.09,14.018,23.024,29]nonacosa-3(8),4,6,9(14),10,12,18,20,22,24(29),25,27-dodecaene |
| SMILES | C=C1C2C(CCc3ccc(-c4ccccc4)cc3-c3ccc(C(C)(C)C)c[n+]31)c1ccccc1-c1ccc(C(C)(C)C)c[n+]12 |
| InChI | InChI=1S/C42H44N2/c1-28-40-36(34-15-11-12-16-35(34)38-23-20-33(27-44(38)40)42(5,6)7)22-19-30-17-18-31(29-13-9-8-10-14-29)25-37(30)39-24-21-32(26-43(28)39)41(2,3)4/h8-18,20-21,23-27,36,40H,1,19,22H2,2-7H3/q+2 |
| InChIKey | OLXASAOMRGUBGF-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.83 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|