C35H28N2O+2 — CID 146958906
6-methyl-2-methylidene-11-oxa-3,36-diazoniaoctacyclo[22.12.0.03,8.09,21.010,18.012,17.025,30.031,36]hexatriaconta-3(8),4,6,9(21),10(18),12,14,16,19,25,27,29,31,33,35-pentadecaene (PubChem CID 146958906) has the molecular formula C35H28N2O+2 and a molecular weight of 492.62 g/mol. Its IUPAC name is 6-methyl-2-methylidene-11-oxa-3,36-diazoniaoctacyclo[22.12.0.03,8.09,21.010,18.012,17.025,30.031,36]hexatriaconta-3(8),4,6,9(21),10(18),12,14,16,19,25,27,29,31,33,35-pentadecaene.
| Compound Name | 6-methyl-2-methylidene-11-oxa-3,36-diazoniaoctacyclo[22.12.0.03,8.09,21.010,18.012,17.025,30.031,36]hexatriaconta-3(8),4,6,9(21),10(18),12,14,16,19,25,27,29,31,33,35-pentadecaene |
|---|---|
| PubChem CID | 146958906 |
| Molecular Formula | C35H28N2O+2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 6-methyl-2-methylidene-11-oxa-3,36-diazoniaoctacyclo[22.12.0.03,8.09,21.010,18.012,17.025,30.031,36]hexatriaconta-3(8),4,6,9(21),10(18),12,14,16,19,25,27,29,31,33,35-pentadecaene |
| SMILES | C=C1C2C(CCc3ccc4c(oc5ccccc54)c3-c3cc(C)cc[n+]31)c1ccccc1-c1cccc[n+]12 |
| InChI | InChI=1S/C35H28N2O/c1-22-18-20-36-23(2)34-28(25-9-3-4-10-26(25)30-12-7-8-19-37(30)34)16-14-24-15-17-29-27-11-5-6-13-32(27)38-35(29)33(24)31(36)21-22/h3-13,15,17-21,28,34H,2,14,16H2,1H3/q+2 |
| InChIKey | WGMJUEBBQXKBAO-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 20.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|