C32H24N2O+2 — CID 170442204
9-[2-(1-ethenylpyridin-1-ium-2-yl)phenyl]-5-methyl-20-oxa-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14,16,18-nonaene (PubChem CID 170442204) has the molecular formula C32H24N2O+2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 9-[2-(1-ethenylpyridin-1-ium-2-yl)phenyl]-5-methyl-20-oxa-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14,16,18-nonaene.
| Compound Name | 9-[2-(1-ethenylpyridin-1-ium-2-yl)phenyl]-5-methyl-20-oxa-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 170442204 |
| Molecular Formula | C32H24N2O+2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 9-[2-(1-ethenylpyridin-1-ium-2-yl)phenyl]-5-methyl-20-oxa-8-azoniapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3(8),4,6,11,14,16,18-nonaene |
| SMILES | C=C[n+]1ccccc1-c1ccccc1C1c2ccc3c(oc4ccccc43)c2-c2cc(C)cc[n+]21 |
| InChI | InChI=1S/C32H24N2O/c1-3-33-18-9-8-13-27(33)22-10-4-5-12-24(22)31-26-16-15-25-23-11-6-7-14-29(23)35-32(25)30(26)28-20-21(2)17-19-34(28)31/h3-20,31H,1H2,2H3/q+2 |
| InChIKey | MSVBRZRCTOPTKJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 20.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|