C47H59N2+ — CID 123929728
3-[3-[1,4-diethyl-3-[2-(2-methylphenyl)pyridin-1-ium-1-yl]cyclobut-2-en-1-yl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-5,5,8,8-tetramethyl-6,7-dihydroisoquinoline (PubChem CID 123929728) has the molecular formula C47H59N2+ and a molecular weight of 652.00 g/mol. Its IUPAC name is 3-[3-[1,4-diethyl-3-[2-(2-methylphenyl)pyridin-1-ium-1-yl]cyclobut-2-en-1-yl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-5,5,8,8-tetramethyl-6,7-dihydroisoquinoline.
| Compound Name | 3-[3-[1,4-diethyl-3-[2-(2-methylphenyl)pyridin-1-ium-1-yl]cyclobut-2-en-1-yl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-5,5,8,8-tetramethyl-6,7-dihydroisoquinoline |
|---|---|
| PubChem CID | 123929728 |
| Molecular Formula | C47H59N2+ |
| Molecular Weight | 652.00 g/mol |
| Exact Mass | 651.47 |
| IUPAC Name | 3-[3-[1,4-diethyl-3-[2-(2-methylphenyl)pyridin-1-ium-1-yl]cyclobut-2-en-1-yl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-5,5,8,8-tetramethyl-6,7-dihydroisoquinoline |
| SMILES | CCC1C([n+]2ccccc2-c2ccccc2C)=CC1(CC)c1cc2c(cc1-c1cc3c(cn1)C(C)(C)CCC3(C)C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C47H59N2/c1-12-34-42(49-25-17-16-20-41(49)32-19-15-14-18-31(32)3)29-47(34,13-2)35-27-37-36(43(4,5)21-22-44(37,6)7)26-33(35)40-28-38-39(30-48-40)46(10,11)24-23-45(38,8)9/h14-20,25-30,34H,12-13,21-24H2,1-11H3/q+1 |
| InChIKey | DDKZKQYSVCQQPA-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.00 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|