C21H28N+ — CID 123387746
8,9,14-triethyl-8,9-dimethyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2,4,6,10,12-hexaene (PubChem CID 123387746) has the molecular formula C21H28N+ and a molecular weight of 294.46 g/mol. Its IUPAC name is 8,9,14-triethyl-8,9-dimethyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2,4,6,10,12-hexaene.
| Compound Name | 8,9,14-triethyl-8,9-dimethyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 123387746 |
| Molecular Formula | C21H28N+ |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 8,9,14-triethyl-8,9-dimethyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2,4,6,10,12-hexaene |
| SMILES | CC[n+]1c2cccc1C(C)(CC)C(C)(CC)c1ccccc1-2 |
| InChI | InChI=1S/C21H28N/c1-6-20(4)17-13-10-9-12-16(17)18-14-11-15-19(22(18)8-3)21(20,5)7-2/h9-15H,6-8H2,1-5H3/q+1 |
| InChIKey | QLKLRGXPMVKYQF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|