C24H24N3+ — CID 91376175
18,19-diethyl-18,19-dimethyl-10,20-diaza-2-azoniahexacyclo[11.7.1.02,11.03,8.04,20.017,21]henicosa-1(21),2,4,6,8,10,12,14,16-nonaene (PubChem CID 91376175) has the molecular formula C24H24N3+ and a molecular weight of 354.48 g/mol. Its IUPAC name is 18,19-diethyl-18,19-dimethyl-10,20-diaza-2-azoniahexacyclo[11.7.1.02,11.03,8.04,20.017,21]henicosa-1(21),2,4,6,8,10,12,14,16-nonaene.
| Compound Name | 18,19-diethyl-18,19-dimethyl-10,20-diaza-2-azoniahexacyclo[11.7.1.02,11.03,8.04,20.017,21]henicosa-1(21),2,4,6,8,10,12,14,16-nonaene |
|---|---|
| PubChem CID | 91376175 |
| Molecular Formula | C24H24N3+ |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 18,19-diethyl-18,19-dimethyl-10,20-diaza-2-azoniahexacyclo[11.7.1.02,11.03,8.04,20.017,21]henicosa-1(21),2,4,6,8,10,12,14,16-nonaene |
| SMILES | CCC1(C)c2cccc3cc4ncc5cccc6c5[n+]4c(c23)n6C1(C)CC |
| InChI | InChI=1S/C24H24N3/c1-5-23(3)17-11-7-9-15-13-19-25-14-16-10-8-12-18-21(16)26(19)22(20(15)17)27(18)24(23,4)6-2/h7-14H,5-6H2,1-4H3/q+1 |
| InChIKey | FCCBFELKIPDDRQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 21.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|