C33H46N3+ — CID 123778996
3-(3-butylphenyl)-9,10,10-triethyl-2,2,9,12,13-pentamethyl-3,11-diaza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),4,6,8(15),12-pentaene (PubChem CID 123778996) has the molecular formula C33H46N3+ and a molecular weight of 484.75 g/mol. Its IUPAC name is 3-(3-butylphenyl)-9,10,10-triethyl-2,2,9,12,13-pentamethyl-3,11-diaza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),4,6,8(15),12-pentaene.
| Compound Name | 3-(3-butylphenyl)-9,10,10-triethyl-2,2,9,12,13-pentamethyl-3,11-diaza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),4,6,8(15),12-pentaene |
|---|---|
| PubChem CID | 123778996 |
| Molecular Formula | C33H46N3+ |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 484.37 |
| IUPAC Name | 3-(3-butylphenyl)-9,10,10-triethyl-2,2,9,12,13-pentamethyl-3,11-diaza-1-azoniatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),4,6,8(15),12-pentaene |
| SMILES | CCCCc1cccc(N2c3cccc4c3-c3n(c(C)c(C)[n+]3C2(C)C)C(CC)(CC)C4(C)CC)c1 |
| InChI | InChI=1S/C33H46N3/c1-10-14-17-25-18-15-19-26(22-25)36-28-21-16-20-27-29(28)30-34(31(36,7)8)23(5)24(6)35(30)33(12-3,13-4)32(27,9)11-2/h15-16,18-22H,10-14,17H2,1-9H3/q+1 |
| InChIKey | JZRVKCUJPQHRAC-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|