C20H24N3+ — CID 123873505
2,3-diethyl-2,3,10-trimethyl-7,13-diaza-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,9,11,13-heptaene (PubChem CID 123873505) has the molecular formula C20H24N3+ and a molecular weight of 306.43 g/mol. Its IUPAC name is 2,3-diethyl-2,3,10-trimethyl-7,13-diaza-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,9,11,13-heptaene.
| Compound Name | 2,3-diethyl-2,3,10-trimethyl-7,13-diaza-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 123873505 |
| Molecular Formula | C20H24N3+ |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 2,3-diethyl-2,3,10-trimethyl-7,13-diaza-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4(16),5,7,9,11,13-heptaene |
| SMILES | CCC1(C)c2ccnc3cc(C)c4cnc[n+](c4c23)C1(C)CC |
| InChI | InChI=1S/C20H24N3/c1-6-19(4)15-8-9-22-16-10-13(3)14-11-21-12-23(18(14)17(15)16)20(19,5)7-2/h8-12H,6-7H2,1-5H3/q+1 |
| InChIKey | FSSIRISRRQEOKF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|