C18H18N2 — CID 142137055
4-[(6,7-dimethylquinolin-4-yl)methyl]aniline (PubChem CID 142137055) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-[(6,7-dimethylquinolin-4-yl)methyl]aniline.
| Compound Name | 4-[(6,7-dimethylquinolin-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 142137055 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-[(6,7-dimethylquinolin-4-yl)methyl]aniline |
| SMILES | Cc1cc2nccc(Cc3ccc(N)cc3)c2cc1C |
| InChI | InChI=1S/C18H18N2/c1-12-9-17-15(7-8-20-18(17)10-13(12)2)11-14-3-5-16(19)6-4-14/h3-10H,11,19H2,1-2H3 |
| InChIKey | CXCDWZYFJHNYPU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|