C24H28N4 — CID 129043065
5-[[4-[(4-amino-2-methylphenyl)methyl]quinolin-7-yl]methyl]-5-azaspiro[2.4]heptan-7-amine (PubChem CID 129043065) has the molecular formula C24H28N4 and a molecular weight of 372.52 g/mol. Its IUPAC name is 5-[[4-[(4-amino-2-methylphenyl)methyl]quinolin-7-yl]methyl]-5-azaspiro[2.4]heptan-7-amine.
| Compound Name | 5-[[4-[(4-amino-2-methylphenyl)methyl]quinolin-7-yl]methyl]-5-azaspiro[2.4]heptan-7-amine |
|---|---|
| PubChem CID | 129043065 |
| Molecular Formula | C24H28N4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 5-[[4-[(4-amino-2-methylphenyl)methyl]quinolin-7-yl]methyl]-5-azaspiro[2.4]heptan-7-amine |
| SMILES | Cc1cc(N)ccc1Cc1ccnc2cc(CN3CC(N)C4(CC4)C3)ccc12 |
| InChI | InChI=1S/C24H28N4/c1-16-10-20(25)4-3-18(16)12-19-6-9-27-22-11-17(2-5-21(19)22)13-28-14-23(26)24(15-28)7-8-24/h2-6,9-11,23H,7-8,12-15,25-26H2,1H3 |
| InChIKey | DSXSZUXGZJTZTI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|