C18H25N3 — CID 103001497
4-N-(4,4-dimethylcyclohexyl)-4-N-methylquinoline-4,7-diamine (PubChem CID 103001497) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-N-(4,4-dimethylcyclohexyl)-4-N-methylquinoline-4,7-diamine.
| Compound Name | 4-N-(4,4-dimethylcyclohexyl)-4-N-methylquinoline-4,7-diamine |
|---|---|
| PubChem CID | 103001497 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 4-N-(4,4-dimethylcyclohexyl)-4-N-methylquinoline-4,7-diamine |
| SMILES | CN(c1ccnc2cc(N)ccc12)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C18H25N3/c1-18(2)9-6-14(7-10-18)21(3)17-8-11-20-16-12-13(19)4-5-15(16)17/h4-5,8,11-12,14H,6-7,9-10,19H2,1-3H3 |
| InChIKey | XDIPOWLBPUPNEQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|