C15H19N3O — CID 103000505
4-N-methyl-4-N-(oxan-4-yl)quinoline-4,7-diamine (PubChem CID 103000505) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 4-N-methyl-4-N-(oxan-4-yl)quinoline-4,7-diamine.
| Compound Name | 4-N-methyl-4-N-(oxan-4-yl)quinoline-4,7-diamine |
|---|---|
| PubChem CID | 103000505 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 4-N-methyl-4-N-(oxan-4-yl)quinoline-4,7-diamine |
| SMILES | CN(c1ccnc2cc(N)ccc12)C1CCOCC1 |
| InChI | InChI=1S/C15H19N3O/c1-18(12-5-8-19-9-6-12)15-4-7-17-14-10-11(16)2-3-13(14)15/h2-4,7,10,12H,5-6,8-9,16H2,1H3 |
| InChIKey | HTBMVIMORQZNPO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|