C11H14ClN3 — CID 17039963
(6,7-dimethylquinolin-4-yl)hydrazine;hydrochloride (PubChem CID 17039963) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is (6,7-dimethylquinolin-4-yl)hydrazine;hydrochloride.
| Compound Name | (6,7-dimethylquinolin-4-yl)hydrazine;hydrochloride |
|---|---|
| PubChem CID | 17039963 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | (6,7-dimethylquinolin-4-yl)hydrazine;hydrochloride |
| SMILES | Cc1cc2nccc(NN)c2cc1C.Cl |
| InChI | InChI=1S/C11H13N3.ClH/c1-7-5-9-10(14-12)3-4-13-11(9)6-8(7)2;/h3-6H,12H2,1-2H3,(H,13,14);1H |
| InChIKey | MKNTVJCBBZRUJN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|