C10H14N6 — CID 100828917
(3-hydrazinyl-6,7-dimethylquinoxalin-2-yl)hydrazine (PubChem CID 100828917) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is (3-hydrazinyl-6,7-dimethylquinoxalin-2-yl)hydrazine.
| Compound Name | (3-hydrazinyl-6,7-dimethylquinoxalin-2-yl)hydrazine |
|---|---|
| PubChem CID | 100828917 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (3-hydrazinyl-6,7-dimethylquinoxalin-2-yl)hydrazine |
| SMILES | Cc1cc2nc(NN)c(NN)nc2cc1C |
| InChI | InChI=1S/C10H14N6/c1-5-3-7-8(4-6(5)2)14-10(16-12)9(13-7)15-11/h3-4H,11-12H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | HHCYHYOLUQUDAE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|