C10H11ClN4O2 — CID 142406445
(3-chloro-6,7-dimethoxyquinoxalin-2-yl)hydrazine (PubChem CID 142406445) has the molecular formula C10H11ClN4O2 and a molecular weight of 254.68 g/mol. Its IUPAC name is (3-chloro-6,7-dimethoxyquinoxalin-2-yl)hydrazine.
| Compound Name | (3-chloro-6,7-dimethoxyquinoxalin-2-yl)hydrazine |
|---|---|
| PubChem CID | 142406445 |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | (3-chloro-6,7-dimethoxyquinoxalin-2-yl)hydrazine |
| SMILES | COc1cc2nc(Cl)c(NN)nc2cc1OC |
| InChI | InChI=1S/C10H11ClN4O2/c1-16-7-3-5-6(4-8(7)17-2)14-10(15-12)9(11)13-5/h3-4H,12H2,1-2H3,(H,14,15) |
| InChIKey | YXGIJLMFFUALGR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|