C10H12N4 — CID 55280218
(5,7-dimethyl-1,8-naphthyridin-4-yl)hydrazine (PubChem CID 55280218) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is (5,7-dimethyl-1,8-naphthyridin-4-yl)hydrazine.
| Compound Name | (5,7-dimethyl-1,8-naphthyridin-4-yl)hydrazine |
|---|---|
| PubChem CID | 55280218 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | (5,7-dimethyl-1,8-naphthyridin-4-yl)hydrazine |
| SMILES | Cc1cc(C)c2c(NN)ccnc2n1 |
| InChI | InChI=1S/C10H12N4/c1-6-5-7(2)13-10-9(6)8(14-11)3-4-12-10/h3-5H,11H2,1-2H3,(H,12,13,14) |
| InChIKey | IEADPBHABLVYNK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|